C14H16N6S — CID 72854369
2-methyl-4-[[4-(3-methyl-1-prop-2-enylpyrazol-4-yl)triazol-1-yl]methyl]-1,3-thiazole (PubChem CID 72854369) has the molecular formula C14H16N6S and a molecular weight of 300.39 g/mol. Its IUPAC name is 2-methyl-4-[[4-(3-methyl-1-prop-2-enylpyrazol-4-yl)triazol-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-methyl-4-[[4-(3-methyl-1-prop-2-enylpyrazol-4-yl)triazol-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 72854369 |
| Molecular Formula | C14H16N6S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-methyl-4-[[4-(3-methyl-1-prop-2-enylpyrazol-4-yl)triazol-1-yl]methyl]-1,3-thiazole |
| SMILES | C=CCn1cc(-c2cn(Cc3csc(C)n3)nn2)c(C)n1 |
| InChI | InChI=1S/C14H16N6S/c1-4-5-19-7-13(10(2)17-19)14-8-20(18-16-14)6-12-9-21-11(3)15-12/h4,7-9H,1,5-6H2,2-3H3 |
| InChIKey | IPWPQGAYYSOTJV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|