C19H27N3O3 — CID 72854538
N-(furan-2-ylmethyl)-2-[(1S,5R)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]acetamide (PubChem CID 72854538) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(1S,5R)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(1S,5R)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]acetamide |
|---|---|
| PubChem CID | 72854538 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(1S,5R)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]acetamide |
| SMILES | CC(C)=CCN1C(=O)[C@H]2CC[C@@H]1CN(CC(=O)NCc1ccco1)C2 |
| InChI | InChI=1S/C19H27N3O3/c1-14(2)7-8-22-16-6-5-15(19(22)24)11-21(12-16)13-18(23)20-10-17-4-3-9-25-17/h3-4,7,9,15-16H,5-6,8,10-13H2,1-2H3,(H,20,23)/t15-,16+/m0/s1 |
| InChIKey | WUXVIEPXBDUPPV-JKSUJKDBSA-N |
| XLogP | 1.78 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|