C22H27N5O2 — CID 72855069
2-[[(1S,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-6-yl]methyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 72855069) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[[(1S,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-6-yl]methyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[[(1S,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-6-yl]methyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 72855069 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 2-[[(1S,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-6-yl]methyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | Cc1noc(C)c1CN1C[C@@H]2CC[C@H](C1)N(Cc1nnc(-c3ccccc3)o1)C2 |
| InChI | InChI=1S/C22H27N5O2/c1-15-20(16(2)29-25-15)13-26-10-17-8-9-19(12-26)27(11-17)14-21-23-24-22(28-21)18-6-4-3-5-7-18/h3-7,17,19H,8-14H2,1-2H3/t17-,19+/m0/s1 |
| InChIKey | VTWFDFJHKBOMQH-PKOBYXMFSA-N |
| XLogP | 3.44 |
| TPSA | 71.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |