C22H29N5O — CID 72864834
3,5-dimethyl-4-[[(1S,5R)-6-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-3-yl]methyl]-1,2-oxazole (PubChem CID 72864834) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 3,5-dimethyl-4-[[(1S,5R)-6-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-3-yl]methyl]-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[[(1S,5R)-6-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-3-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 72864834 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 3,5-dimethyl-4-[[(1S,5R)-6-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3,6-diazabicyclo[3.2.2]nonan-3-yl]methyl]-1,2-oxazole |
| SMILES | Cc1ccn2cc(CN3C[C@H]4CC[C@@H]3CN(Cc3c(C)noc3C)C4)nc2c1 |
| InChI | InChI=1S/C22H29N5O/c1-15-6-7-26-11-19(23-22(26)8-15)12-27-10-18-4-5-20(27)13-25(9-18)14-21-16(2)24-28-17(21)3/h6-8,11,18,20H,4-5,9-10,12-14H2,1-3H3/t18-,20+/m0/s1 |
| InChIKey | YMJNDOMLCJLSCO-AZUAARDMSA-N |
| XLogP | 3.34 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |