About phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone
phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone (PubChem CID 728562) has the molecular formula C15H12O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone.
Molecular Properties
| Compound Name | phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone |
| PubChem CID | 728562 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone |
| SMILES | O=C(c1ccccc1)[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H12O2/c16-13(11-7-3-1-4-8-11)15-14(17-15)12-9-5-2-6-10-12/h1-10,14-15H/t14-,15-/m0/s1 |
| InChIKey | UQGMJZQVDNZRKT-GJZGRUSLSA-N |
| XLogP | 3.01 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone?
The IUPAC name of phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone (CID 728562) is phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone.
What is the SMILES notation for phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone?
The canonical SMILES for phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone is O=C(c1ccccc1)[C@@H]1O[C@H]1c1ccccc1.
What is the InChIKey of phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone?
The InChIKey is UQGMJZQVDNZRKT-GJZGRUSLSA-N. The full InChI is InChI=1S/C15H12O2/c16-13(11-7-3-1-4-8-11)15-14(17-15)12-9-5-2-6-10-12/h1-10,14-15H/t14-,15-/m0/s1.
What are the key properties of phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone?
phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone has a molecular weight of 224.26 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-[(2R,3S)-3-phenyloxiran-2-yl]methanone is sourced from PubChem (CID 728562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).