C19H18N4O4 — CID 72856204
2-[methyl-[2-(4-methyl-1-oxophthalazin-2-yl)acetyl]amino]-2-pyridin-3-ylacetic acid (PubChem CID 72856204) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is 2-[methyl-[2-(4-methyl-1-oxophthalazin-2-yl)acetyl]amino]-2-pyridin-3-ylacetic acid.
| Compound Name | 2-[methyl-[2-(4-methyl-1-oxophthalazin-2-yl)acetyl]amino]-2-pyridin-3-ylacetic acid |
|---|---|
| PubChem CID | 72856204 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[methyl-[2-(4-methyl-1-oxophthalazin-2-yl)acetyl]amino]-2-pyridin-3-ylacetic acid |
| SMILES | Cc1nn(CC(=O)N(C)C(C(=O)O)c2cccnc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H18N4O4/c1-12-14-7-3-4-8-15(14)18(25)23(21-12)11-16(24)22(2)17(19(26)27)13-6-5-9-20-10-13/h3-10,17H,11H2,1-2H3,(H,26,27) |
| InChIKey | FKJVWNHTRSLKES-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |