C20H25F3N4O — CID 72857287
1-[3-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]piperidin-1-yl]-2-(2,3,4-trifluorophenyl)ethanone (PubChem CID 72857287) has the molecular formula C20H25F3N4O and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-[3-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]piperidin-1-yl]-2-(2,3,4-trifluorophenyl)ethanone.
| Compound Name | 1-[3-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]piperidin-1-yl]-2-(2,3,4-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 72857287 |
| Molecular Formula | C20H25F3N4O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-[3-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]piperidin-1-yl]-2-(2,3,4-trifluorophenyl)ethanone |
| SMILES | CN(C)CCn1ccnc1C1CCCN(C(=O)Cc2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C20H25F3N4O/c1-25(2)10-11-26-9-7-24-20(26)15-4-3-8-27(13-15)17(28)12-14-5-6-16(21)19(23)18(14)22/h5-7,9,15H,3-4,8,10-13H2,1-2H3 |
| InChIKey | QWRIAKFGGOQJGU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|