C23H27N3O5 — CID 7285795
N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]-N'-(2,3-dimethylphenyl)oxamide (PubChem CID 7285795) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]-N'-(2,3-dimethylphenyl)oxamide.
| Compound Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]-N'-(2,3-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 7285795 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]-N'-(2,3-dimethylphenyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NC[C@H](c2ccc3c(c2)OCO3)N2CCOCC2)c1C |
| InChI | InChI=1S/C23H27N3O5/c1-15-4-3-5-18(16(15)2)25-23(28)22(27)24-13-19(26-8-10-29-11-9-26)17-6-7-20-21(12-17)31-14-30-20/h3-7,12,19H,8-11,13-14H2,1-2H3,(H,24,27)(H,25,28)/t19-/m1/s1 |
| InChIKey | YHTQWYPZMAENAA-LJQANCHMSA-N |
| XLogP | 2.16 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|