About 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide
1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide (PubChem CID 72858255) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide |
| PubChem CID | 72858255 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)C2(C(N)=O)CC2)C[C@@]1(O)C1CCC1 |
| InChI | InChI=1S/C14H22N2O3/c1-9-7-16(8-14(9,19)10-3-2-4-10)12(18)13(5-6-13)11(15)17/h9-10,19H,2-8H2,1H3,(H2,15,17)/t9-,14+/m1/s1 |
| InChIKey | FCGIJMVMOGPTFK-OTYXRUKQSA-N |
| XLogP | 0.26 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide?
The IUPAC name of 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide (CID 72858255) is 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide.
What is the SMILES notation for 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide?
The canonical SMILES for 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide is C[C@@H]1CN(C(=O)C2(C(N)=O)CC2)C[C@@]1(O)C1CCC1.
What is the InChIKey of 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide?
The InChIKey is FCGIJMVMOGPTFK-OTYXRUKQSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-9-7-16(8-14(9,19)10-3-2-4-10)12(18)13(5-6-13)11(15)17/h9-10,19H,2-8H2,1H3,(H2,15,17)/t9-,14+/m1/s1.
What are the key properties of 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide?
1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide has a molecular weight of 266.34 g/mol, XLogP of 0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R,4R)-3-cyclobutyl-3-hydroxy-4-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxamide is sourced from PubChem (CID 72858255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).