C13H16ClN3O3S — CID 72858954
N-(2-chloro-5-sulfamoylphenyl)-4-methyl-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 72858954) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is N-(2-chloro-5-sulfamoylphenyl)-4-methyl-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-(2-chloro-5-sulfamoylphenyl)-4-methyl-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 72858954 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-(2-chloro-5-sulfamoylphenyl)-4-methyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CC1=CCN(C(=O)Nc2cc(S(N)(=O)=O)ccc2Cl)CC1 |
| InChI | InChI=1S/C13H16ClN3O3S/c1-9-4-6-17(7-5-9)13(18)16-12-8-10(21(15,19)20)2-3-11(12)14/h2-4,8H,5-7H2,1H3,(H,16,18)(H2,15,19,20) |
| InChIKey | SXRRTBBVYQYYFS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|