C16H20N4O3 — CID 72859372
8-methoxy-N-[3-(1,2,4-triazol-1-yl)propyl]-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 72859372) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 8-methoxy-N-[3-(1,2,4-triazol-1-yl)propyl]-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | 8-methoxy-N-[3-(1,2,4-triazol-1-yl)propyl]-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 72859372 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 8-methoxy-N-[3-(1,2,4-triazol-1-yl)propyl]-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | COc1cccc2c1OCC(C(=O)NCCCn1cncn1)C2 |
| InChI | InChI=1S/C16H20N4O3/c1-22-14-5-2-4-12-8-13(9-23-15(12)14)16(21)18-6-3-7-20-11-17-10-19-20/h2,4-5,10-11,13H,3,6-9H2,1H3,(H,18,21) |
| InChIKey | SQEQCQVTMFOJSN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|