C20H30N4O2 — CID 72859950
[2-(2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea (PubChem CID 72859950) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is [2-(2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea.
| Compound Name | [2-(2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 72859950 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | [2-(2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)-2-oxoethyl]urea |
| SMILES | CCN1CC(c2ccccc2)CC2(CCN(C(=O)CNC(N)=O)CC2)C1 |
| InChI | InChI=1S/C20H30N4O2/c1-2-23-14-17(16-6-4-3-5-7-16)12-20(15-23)8-10-24(11-9-20)18(25)13-22-19(21)26/h3-7,17H,2,8-15H2,1H3,(H3,21,22,26) |
| InChIKey | DHWLGZYFYWJYOO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |