C22H33N3O2 — CID 72896512
5-(2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)-5-oxopentanamide (PubChem CID 72896512) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 5-(2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)-5-oxopentanamide.
| Compound Name | 5-(2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)-5-oxopentanamide |
|---|---|
| PubChem CID | 72896512 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 5-(2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl)-5-oxopentanamide |
| SMILES | CCN1CC(c2ccccc2)CC2(CCN(C(=O)CCCC(N)=O)CC2)C1 |
| InChI | InChI=1S/C22H33N3O2/c1-2-24-16-19(18-7-4-3-5-8-18)15-22(17-24)11-13-25(14-12-22)21(27)10-6-9-20(23)26/h3-5,7-8,19H,2,6,9-17H2,1H3,(H2,23,26) |
| InChIKey | HYZIYHZZLHAMCR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |