C16H23ClN4O4 — CID 72860855
1-[(4aR,8aR)-7-(4-chloro-1-methylpyrazole-5-carbonyl)-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-2-methoxyethanone (PubChem CID 72860855) has the molecular formula C16H23ClN4O4 and a molecular weight of 370.84 g/mol. Its IUPAC name is 1-[(4aR,8aR)-7-(4-chloro-1-methylpyrazole-5-carbonyl)-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-2-methoxyethanone.
| Compound Name | 1-[(4aR,8aR)-7-(4-chloro-1-methylpyrazole-5-carbonyl)-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 72860855 |
| Molecular Formula | C16H23ClN4O4 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[(4aR,8aR)-7-(4-chloro-1-methylpyrazole-5-carbonyl)-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CC[C@]2(O)CCN(C(=O)c3c(Cl)cnn3C)C[C@@H]2C1 |
| InChI | InChI=1S/C16H23ClN4O4/c1-19-14(12(17)7-18-19)15(23)21-6-4-16(24)3-5-20(8-11(16)9-21)13(22)10-25-2/h7,11,24H,3-6,8-10H2,1-2H3/t11-,16-/m0/s1 |
| InChIKey | DUGFHQMNKYPYJY-ZBEGNZNMSA-N |
| XLogP | 0.15 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |