C20H25ClFN3O — CID 72861491
[3-(1-butylimidazol-2-yl)piperidin-1-yl]-(2-chloro-6-fluoro-3-methylphenyl)methanone (PubChem CID 72861491) has the molecular formula C20H25ClFN3O and a molecular weight of 377.89 g/mol. Its IUPAC name is [3-(1-butylimidazol-2-yl)piperidin-1-yl]-(2-chloro-6-fluoro-3-methylphenyl)methanone.
| Compound Name | [3-(1-butylimidazol-2-yl)piperidin-1-yl]-(2-chloro-6-fluoro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 72861491 |
| Molecular Formula | C20H25ClFN3O |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [3-(1-butylimidazol-2-yl)piperidin-1-yl]-(2-chloro-6-fluoro-3-methylphenyl)methanone |
| SMILES | CCCCn1ccnc1C1CCCN(C(=O)c2c(F)ccc(C)c2Cl)C1 |
| InChI | InChI=1S/C20H25ClFN3O/c1-3-4-10-24-12-9-23-19(24)15-6-5-11-25(13-15)20(26)17-16(22)8-7-14(2)18(17)21/h7-9,12,15H,3-6,10-11,13H2,1-2H3 |
| InChIKey | NLKWFIDCGBCCMW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |