C20H24ClF2N3O — CID 97285756
1-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-2-(2-chloro-4,5-difluorophenyl)ethanone (PubChem CID 97285756) has the molecular formula C20H24ClF2N3O and a molecular weight of 395.88 g/mol. Its IUPAC name is 1-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-2-(2-chloro-4,5-difluorophenyl)ethanone.
| Compound Name | 1-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-2-(2-chloro-4,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 97285756 |
| Molecular Formula | C20H24ClF2N3O |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-2-(2-chloro-4,5-difluorophenyl)ethanone |
| SMILES | CCCCn1ccnc1[C@@H]1CCCN(C(=O)Cc2cc(F)c(F)cc2Cl)C1 |
| InChI | InChI=1S/C20H24ClF2N3O/c1-2-3-7-25-9-6-24-20(25)14-5-4-8-26(13-14)19(27)11-15-10-17(22)18(23)12-16(15)21/h6,9-10,12,14H,2-5,7-8,11,13H2,1H3/t14-/m1/s1 |
| InChIKey | BTGBNLCHGRNDES-CQSZACIVSA-N |
| XLogP | 4.56 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|