C20H29N5O — CID 72861499
1-[(3-cyclopropyl-1H-pyrazol-5-yl)methyl]-3-[3-(diethylaminomethyl)phenyl]-1-methylurea (PubChem CID 72861499) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 1-[(3-cyclopropyl-1H-pyrazol-5-yl)methyl]-3-[3-(diethylaminomethyl)phenyl]-1-methylurea.
| Compound Name | 1-[(3-cyclopropyl-1H-pyrazol-5-yl)methyl]-3-[3-(diethylaminomethyl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 72861499 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 1-[(3-cyclopropyl-1H-pyrazol-5-yl)methyl]-3-[3-(diethylaminomethyl)phenyl]-1-methylurea |
| SMILES | CCN(CC)Cc1cccc(NC(=O)N(C)Cc2cc(C3CC3)n[nH]2)c1 |
| InChI | InChI=1S/C20H29N5O/c1-4-25(5-2)13-15-7-6-8-17(11-15)21-20(26)24(3)14-18-12-19(23-22-18)16-9-10-16/h6-8,11-12,16H,4-5,9-10,13-14H2,1-3H3,(H,21,26)(H,22,23) |
| InChIKey | YHMSANFHMYOBCB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |