C19H31N3O2 — CID 72862427
4-[3-[(3S,4R)-3-(dimethylamino)-4-propan-2-ylpyrrolidin-1-yl]propoxy]benzamide (PubChem CID 72862427) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 4-[3-[(3S,4R)-3-(dimethylamino)-4-propan-2-ylpyrrolidin-1-yl]propoxy]benzamide.
| Compound Name | 4-[3-[(3S,4R)-3-(dimethylamino)-4-propan-2-ylpyrrolidin-1-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 72862427 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 4-[3-[(3S,4R)-3-(dimethylamino)-4-propan-2-ylpyrrolidin-1-yl]propoxy]benzamide |
| SMILES | CC(C)[C@@H]1CN(CCCOc2ccc(C(N)=O)cc2)C[C@H]1N(C)C |
| InChI | InChI=1S/C19H31N3O2/c1-14(2)17-12-22(13-18(17)21(3)4)10-5-11-24-16-8-6-15(7-9-16)19(20)23/h6-9,14,17-18H,5,10-13H2,1-4H3,(H2,20,23)/t17-,18+/m0/s1 |
| InChIKey | KDMAZZWXZYSHFB-ZWKOTPCHSA-N |
| XLogP | 2.07 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|