C17H26N2O3 — CID 95972620
4-[3-[[(2S)-5-methylhexan-2-yl]amino]-3-oxopropoxy]benzamide (PubChem CID 95972620) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-[3-[[(2S)-5-methylhexan-2-yl]amino]-3-oxopropoxy]benzamide.
| Compound Name | 4-[3-[[(2S)-5-methylhexan-2-yl]amino]-3-oxopropoxy]benzamide |
|---|---|
| PubChem CID | 95972620 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 4-[3-[[(2S)-5-methylhexan-2-yl]amino]-3-oxopropoxy]benzamide |
| SMILES | CC(C)CC[C@H](C)NC(=O)CCOc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-12(2)4-5-13(3)19-16(20)10-11-22-15-8-6-14(7-9-15)17(18)21/h6-9,12-13H,4-5,10-11H2,1-3H3,(H2,18,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | QFBLGZRZKBNQNX-ZDUSSCGKSA-N |
| XLogP | 2.50 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |