C19H21ClN2O4 — CID 72862619
2-(2-chlorophenyl)-2-[[1-(furan-2-ylmethyl)piperidine-4-carbonyl]amino]acetic acid (PubChem CID 72862619) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-[[1-(furan-2-ylmethyl)piperidine-4-carbonyl]amino]acetic acid.
| Compound Name | 2-(2-chlorophenyl)-2-[[1-(furan-2-ylmethyl)piperidine-4-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 72862619 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-(2-chlorophenyl)-2-[[1-(furan-2-ylmethyl)piperidine-4-carbonyl]amino]acetic acid |
| SMILES | O=C(NC(C(=O)O)c1ccccc1Cl)C1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C19H21ClN2O4/c20-16-6-2-1-5-15(16)17(19(24)25)21-18(23)13-7-9-22(10-8-13)12-14-4-3-11-26-14/h1-6,11,13,17H,7-10,12H2,(H,21,23)(H,24,25) |
| InChIKey | DVSRBXCCPHKXJX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |