C13H17N5O — CID 72867320
1-[(3,4-dimethylphenyl)methyl]-3-(1-methyltriazol-4-yl)urea (PubChem CID 72867320) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-[(3,4-dimethylphenyl)methyl]-3-(1-methyltriazol-4-yl)urea.
| Compound Name | 1-[(3,4-dimethylphenyl)methyl]-3-(1-methyltriazol-4-yl)urea |
|---|---|
| PubChem CID | 72867320 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-[(3,4-dimethylphenyl)methyl]-3-(1-methyltriazol-4-yl)urea |
| SMILES | Cc1ccc(CNC(=O)Nc2cn(C)nn2)cc1C |
| InChI | InChI=1S/C13H17N5O/c1-9-4-5-11(6-10(9)2)7-14-13(19)15-12-8-18(3)17-16-12/h4-6,8H,7H2,1-3H3,(H2,14,15,19) |
| InChIKey | GDSCINJKLBFCLK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |