C11H17N7O — CID 72905357
1-(1-methyltriazol-4-yl)-3-[(1-propan-2-ylimidazol-2-yl)methyl]urea (PubChem CID 72905357) has the molecular formula C11H17N7O and a molecular weight of 263.31 g/mol. Its IUPAC name is 1-(1-methyltriazol-4-yl)-3-[(1-propan-2-ylimidazol-2-yl)methyl]urea.
| Compound Name | 1-(1-methyltriazol-4-yl)-3-[(1-propan-2-ylimidazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 72905357 |
| Molecular Formula | C11H17N7O |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-(1-methyltriazol-4-yl)-3-[(1-propan-2-ylimidazol-2-yl)methyl]urea |
| SMILES | CC(C)n1ccnc1CNC(=O)Nc1cn(C)nn1 |
| InChI | InChI=1S/C11H17N7O/c1-8(2)18-5-4-12-10(18)6-13-11(19)14-9-7-17(3)16-15-9/h4-5,7-8H,6H2,1-3H3,(H2,13,14,19) |
| InChIKey | URXXPDZIDBCUGY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |