C13H14F3N3O2 — CID 72867723
3-(3-cyano-4-methoxyphenyl)-1-ethyl-1-(2,2,2-trifluoroethyl)urea (PubChem CID 72867723) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is 3-(3-cyano-4-methoxyphenyl)-1-ethyl-1-(2,2,2-trifluoroethyl)urea.
| Compound Name | 3-(3-cyano-4-methoxyphenyl)-1-ethyl-1-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 72867723 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-(3-cyano-4-methoxyphenyl)-1-ethyl-1-(2,2,2-trifluoroethyl)urea |
| SMILES | CCN(CC(F)(F)F)C(=O)Nc1ccc(OC)c(C#N)c1 |
| InChI | InChI=1S/C13H14F3N3O2/c1-3-19(8-13(14,15)16)12(20)18-10-4-5-11(21-2)9(6-10)7-17/h4-6H,3,8H2,1-2H3,(H,18,20) |
| InChIKey | NDKFLXROSNAXNU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |