C19H24N4OS — CID 72868148
4-[(3-methyl-2-pyridinyl)methyl]-N-(4-methylsulfanylphenyl)piperazine-1-carboxamide (PubChem CID 72868148) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 4-[(3-methyl-2-pyridinyl)methyl]-N-(4-methylsulfanylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[(3-methyl-2-pyridinyl)methyl]-N-(4-methylsulfanylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 72868148 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-[(3-methyl-2-pyridinyl)methyl]-N-(4-methylsulfanylphenyl)piperazine-1-carboxamide |
| SMILES | CSc1ccc(NC(=O)N2CCN(Cc3ncccc3C)CC2)cc1 |
| InChI | InChI=1S/C19H24N4OS/c1-15-4-3-9-20-18(15)14-22-10-12-23(13-11-22)19(24)21-16-5-7-17(25-2)8-6-16/h3-9H,10-14H2,1-2H3,(H,21,24) |
| InChIKey | WXLZVRJKSOOLRD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |