C22H28N4O — CID 155873458
[4-anilino-1-[(3-methyl-2-pyridinyl)methyl]piperidin-4-yl]-(azetidin-1-yl)methanone (PubChem CID 155873458) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is [4-anilino-1-[(3-methyl-2-pyridinyl)methyl]piperidin-4-yl]-(azetidin-1-yl)methanone.
| Compound Name | [4-anilino-1-[(3-methyl-2-pyridinyl)methyl]piperidin-4-yl]-(azetidin-1-yl)methanone |
|---|---|
| PubChem CID | 155873458 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | [4-anilino-1-[(3-methyl-2-pyridinyl)methyl]piperidin-4-yl]-(azetidin-1-yl)methanone |
| SMILES | Cc1cccnc1CN1CCC(Nc2ccccc2)(C(=O)N2CCC2)CC1 |
| InChI | InChI=1S/C22H28N4O/c1-18-7-5-12-23-20(18)17-25-15-10-22(11-16-25,21(27)26-13-6-14-26)24-19-8-3-2-4-9-19/h2-5,7-9,12,24H,6,10-11,13-17H2,1H3 |
| InChIKey | NAUMXVXLXMRJRC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |