C32H33N3O — CID 89062689
4-[2-methyl-6-(4-phenylanilino)phenyl]-1-[(3-methyl-2-pyridinyl)methyl]piperidine-4-carbaldehyde (PubChem CID 89062689) has the molecular formula C32H33N3O and a molecular weight of 475.64 g/mol. Its IUPAC name is 4-[2-methyl-6-(4-phenylanilino)phenyl]-1-[(3-methyl-2-pyridinyl)methyl]piperidine-4-carbaldehyde.
| Compound Name | 4-[2-methyl-6-(4-phenylanilino)phenyl]-1-[(3-methyl-2-pyridinyl)methyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 89062689 |
| Molecular Formula | C32H33N3O |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 4-[2-methyl-6-(4-phenylanilino)phenyl]-1-[(3-methyl-2-pyridinyl)methyl]piperidine-4-carbaldehyde |
| SMILES | Cc1cccnc1CN1CCC(C=O)(c2c(C)cccc2Nc2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C32H33N3O/c1-24-9-7-19-33-30(24)22-35-20-17-32(23-36,18-21-35)31-25(2)8-6-12-29(31)34-28-15-13-27(14-16-28)26-10-4-3-5-11-26/h3-16,19,23,34H,17-18,20-22H2,1-2H3 |
| InChIKey | ODDXBPOGRHGHAA-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|