C12H15F4N3O — CID 72868732
5-pyrrolidin-1-yl-2-(3,3,4,4-tetrafluorobutyl)pyridazin-3-one (PubChem CID 72868732) has the molecular formula C12H15F4N3O and a molecular weight of 293.26 g/mol. Its IUPAC name is 5-pyrrolidin-1-yl-2-(3,3,4,4-tetrafluorobutyl)pyridazin-3-one.
| Compound Name | 5-pyrrolidin-1-yl-2-(3,3,4,4-tetrafluorobutyl)pyridazin-3-one |
|---|---|
| PubChem CID | 72868732 |
| Molecular Formula | C12H15F4N3O |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 5-pyrrolidin-1-yl-2-(3,3,4,4-tetrafluorobutyl)pyridazin-3-one |
| SMILES | O=c1cc(N2CCCC2)cnn1CCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H15F4N3O/c13-11(14)12(15,16)3-6-19-10(20)7-9(8-17-19)18-4-1-2-5-18/h7-8,11H,1-6H2 |
| InChIKey | LBTNERTVOQSLJL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|