C21H20N2O3S — CID 7287219
N,4,5-trimethyl-2-[(2-phenoxybenzoyl)amino]thiophene-3-carboxamide (PubChem CID 7287219) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is N,4,5-trimethyl-2-[(2-phenoxybenzoyl)amino]thiophene-3-carboxamide.
| Compound Name | N,4,5-trimethyl-2-[(2-phenoxybenzoyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 7287219 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N,4,5-trimethyl-2-[(2-phenoxybenzoyl)amino]thiophene-3-carboxamide |
| SMILES | CNC(=O)c1c(NC(=O)c2ccccc2Oc2ccccc2)sc(C)c1C |
| InChI | InChI=1S/C21H20N2O3S/c1-13-14(2)27-21(18(13)20(25)22-3)23-19(24)16-11-7-8-12-17(16)26-15-9-5-4-6-10-15/h4-12H,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | XIYGSJMXRRHZEA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |