C19H28N4O3S — CID 72873071
2-[1-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 72873071) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-[1-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[1-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 72873071 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-[1-(3-methylbutyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CC(C)CCN1C(=O)N(CC(=O)NCc2cccs2)C(=O)C12CCNCC2 |
| InChI | InChI=1S/C19H28N4O3S/c1-14(2)5-10-23-18(26)22(17(25)19(23)6-8-20-9-7-19)13-16(24)21-12-15-4-3-11-27-15/h3-4,11,14,20H,5-10,12-13H2,1-2H3,(H,21,24) |
| InChIKey | SXOXNWPMDQDQIU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|