C15H25N3O3S — CID 72873894
[3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-[2-(methylamino)-1,3-thiazol-4-yl]methanone (PubChem CID 72873894) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is [3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-[2-(methylamino)-1,3-thiazol-4-yl]methanone.
| Compound Name | [3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-[2-(methylamino)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 72873894 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | [3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]-[2-(methylamino)-1,3-thiazol-4-yl]methanone |
| SMILES | CNc1nc(C(=O)N2CCCC(CO)(CCCOC)C2)cs1 |
| InChI | InChI=1S/C15H25N3O3S/c1-16-14-17-12(9-22-14)13(20)18-7-3-5-15(10-18,11-19)6-4-8-21-2/h9,19H,3-8,10-11H2,1-2H3,(H,16,17) |
| InChIKey | SDNPKGGXMCEYHW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|