C19H14Cl2N2O3 — CID 7287477
(4S)-2-amino-4-(3,5-dichloro-4-prop-2-ynoxyphenyl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile (PubChem CID 7287477) has the molecular formula C19H14Cl2N2O3 and a molecular weight of 389.24 g/mol. Its IUPAC name is (4S)-2-amino-4-(3,5-dichloro-4-prop-2-ynoxyphenyl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(3,5-dichloro-4-prop-2-ynoxyphenyl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 7287477 |
| Molecular Formula | C19H14Cl2N2O3 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | (4S)-2-amino-4-(3,5-dichloro-4-prop-2-ynoxyphenyl)-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
| SMILES | C#CCOc1c(Cl)cc([C@H]2C(C#N)=C(N)OC3=C2C(=O)CCC3)cc1Cl |
| InChI | InChI=1S/C19H14Cl2N2O3/c1-2-6-25-18-12(20)7-10(8-13(18)21)16-11(9-22)19(23)26-15-5-3-4-14(24)17(15)16/h1,7-8,16H,3-6,23H2/t16-/m0/s1 |
| InChIKey | IAEDIPSABZVYGY-INIZCTEOSA-N |
| XLogP | 3.82 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|