C15H19N3O2S — CID 72876342
5,6-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]pyrimidin-4-amine (PubChem CID 72876342) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 5,6-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 72876342 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5,6-dimethyl-N-[1-(4-methylsulfonylphenyl)ethyl]pyrimidin-4-amine |
| SMILES | Cc1ncnc(NC(C)c2ccc(S(C)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C15H19N3O2S/c1-10-11(2)16-9-17-15(10)18-12(3)13-5-7-14(8-6-13)21(4,19)20/h5-9,12H,1-4H3,(H,16,17,18) |
| InChIKey | SNGXNWLZMSPJRX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |