C19H22N6OS — CID 72876865
1-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea (PubChem CID 72876865) has the molecular formula C19H22N6OS and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea.
| Compound Name | 1-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 72876865 |
| Molecular Formula | C19H22N6OS |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-3-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea |
| SMILES | Cc1nc(-c2ccc(NC(=O)NCCc3nc4c(s3)CCCC4)cc2)n[nH]1 |
| InChI | InChI=1S/C19H22N6OS/c1-12-21-18(25-24-12)13-6-8-14(9-7-13)22-19(26)20-11-10-17-23-15-4-2-3-5-16(15)27-17/h6-9H,2-5,10-11H2,1H3,(H2,20,22,26)(H,21,24,25) |
| InChIKey | LMNKTAXMMLYBBI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |