C18H22ClFN4O — CID 72877104
N-(4-chloro-3-fluorophenyl)-4-[2-(2-methylimidazol-1-yl)ethyl]piperidine-1-carboxamide (PubChem CID 72877104) has the molecular formula C18H22ClFN4O and a molecular weight of 364.85 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-4-[2-(2-methylimidazol-1-yl)ethyl]piperidine-1-carboxamide.
| Compound Name | N-(4-chloro-3-fluorophenyl)-4-[2-(2-methylimidazol-1-yl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 72877104 |
| Molecular Formula | C18H22ClFN4O |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-4-[2-(2-methylimidazol-1-yl)ethyl]piperidine-1-carboxamide |
| SMILES | Cc1nccn1CCC1CCN(C(=O)Nc2ccc(Cl)c(F)c2)CC1 |
| InChI | InChI=1S/C18H22ClFN4O/c1-13-21-7-11-23(13)8-4-14-5-9-24(10-6-14)18(25)22-15-2-3-16(19)17(20)12-15/h2-3,7,11-12,14H,4-6,8-10H2,1H3,(H,22,25) |
| InChIKey | YHSKOERAORYYGK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |