C20H28N2O3S — CID 72878294
3-[1-[2-(2-pyrrolidin-1-ylethylsulfanyl)acetyl]piperidin-3-yl]benzoic acid (PubChem CID 72878294) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 3-[1-[2-(2-pyrrolidin-1-ylethylsulfanyl)acetyl]piperidin-3-yl]benzoic acid.
| Compound Name | 3-[1-[2-(2-pyrrolidin-1-ylethylsulfanyl)acetyl]piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 72878294 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-[1-[2-(2-pyrrolidin-1-ylethylsulfanyl)acetyl]piperidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(C2CCCN(C(=O)CSCCN3CCCC3)C2)c1 |
| InChI | InChI=1S/C20H28N2O3S/c23-19(15-26-12-11-21-8-1-2-9-21)22-10-4-7-18(14-22)16-5-3-6-17(13-16)20(24)25/h3,5-6,13,18H,1-2,4,7-12,14-15H2,(H,24,25) |
| InChIKey | GDKDDYDCCWMEEG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|