C18H23NO3S — CID 97190325
3-[(3R)-1-[2-(cyclopropylmethylsulfanyl)acetyl]piperidin-3-yl]benzoic acid (PubChem CID 97190325) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 3-[(3R)-1-[2-(cyclopropylmethylsulfanyl)acetyl]piperidin-3-yl]benzoic acid.
| Compound Name | 3-[(3R)-1-[2-(cyclopropylmethylsulfanyl)acetyl]piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 97190325 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-[(3R)-1-[2-(cyclopropylmethylsulfanyl)acetyl]piperidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc([C@H]2CCCN(C(=O)CSCC3CC3)C2)c1 |
| InChI | InChI=1S/C18H23NO3S/c20-17(12-23-11-13-6-7-13)19-8-2-5-16(10-19)14-3-1-4-15(9-14)18(21)22/h1,3-4,9,13,16H,2,5-8,10-12H2,(H,21,22)/t16-/m0/s1 |
| InChIKey | SNBHXHUOQSCEEI-INIZCTEOSA-N |
| XLogP | 3.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |