C16H17F3N6 — CID 72879276
3-(2-phenylethyl)-5-[1-(1,2,4-triazol-1-yl)ethyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole (PubChem CID 72879276) has the molecular formula C16H17F3N6 and a molecular weight of 350.35 g/mol. Its IUPAC name is 3-(2-phenylethyl)-5-[1-(1,2,4-triazol-1-yl)ethyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole.
| Compound Name | 3-(2-phenylethyl)-5-[1-(1,2,4-triazol-1-yl)ethyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 72879276 |
| Molecular Formula | C16H17F3N6 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-(2-phenylethyl)-5-[1-(1,2,4-triazol-1-yl)ethyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole |
| SMILES | CC(c1nc(CCc2ccccc2)nn1CC(F)(F)F)n1cncn1 |
| InChI | InChI=1S/C16H17F3N6/c1-12(25-11-20-10-21-25)15-22-14(23-24(15)9-16(17,18)19)8-7-13-5-3-2-4-6-13/h2-6,10-12H,7-9H2,1H3 |
| InChIKey | BZXZYUDZMDPAFL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |