C22H32N4O3 — CID 7287931
N-[1-(cyclopentylcarbamoyl)cyclohexyl]-N-[[(2R)-oxolan-2-yl]methyl]pyrazine-2-carboxamide (PubChem CID 7287931) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[1-(cyclopentylcarbamoyl)cyclohexyl]-N-[[(2R)-oxolan-2-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[1-(cyclopentylcarbamoyl)cyclohexyl]-N-[[(2R)-oxolan-2-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 7287931 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | N-[1-(cyclopentylcarbamoyl)cyclohexyl]-N-[[(2R)-oxolan-2-yl]methyl]pyrazine-2-carboxamide |
| SMILES | O=C(c1cnccn1)N(C[C@H]1CCCO1)C1(C(=O)NC2CCCC2)CCCCC1 |
| InChI | InChI=1S/C22H32N4O3/c27-20(19-15-23-12-13-24-19)26(16-18-9-6-14-29-18)22(10-4-1-5-11-22)21(28)25-17-7-2-3-8-17/h12-13,15,17-18H,1-11,14,16H2,(H,25,28)/t18-/m1/s1 |
| InChIKey | VTVKPIUZZKGCCI-GOSISDBHSA-N |
| XLogP | 2.86 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |