C19H25N5O2 — CID 72880120
2-[(2-cyclopentyl-5-methylpyrazol-3-yl)carbamoylamino]-N-methyl-2-phenylacetamide (PubChem CID 72880120) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[(2-cyclopentyl-5-methylpyrazol-3-yl)carbamoylamino]-N-methyl-2-phenylacetamide.
| Compound Name | 2-[(2-cyclopentyl-5-methylpyrazol-3-yl)carbamoylamino]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 72880120 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2-[(2-cyclopentyl-5-methylpyrazol-3-yl)carbamoylamino]-N-methyl-2-phenylacetamide |
| SMILES | CNC(=O)C(NC(=O)Nc1cc(C)nn1C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H25N5O2/c1-13-12-16(24(23-13)15-10-6-7-11-15)21-19(26)22-17(18(25)20-2)14-8-4-3-5-9-14/h3-5,8-9,12,15,17H,6-7,10-11H2,1-2H3,(H,20,25)(H2,21,22,26) |
| InChIKey | VOGLHVMPQNHJFU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |