C24H27N3O — CID 155523538
N-(2-cyclohexyl-5-methylpyrazol-3-yl)-2-(4-phenylphenyl)acetamide (PubChem CID 155523538) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is N-(2-cyclohexyl-5-methylpyrazol-3-yl)-2-(4-phenylphenyl)acetamide.
| Compound Name | N-(2-cyclohexyl-5-methylpyrazol-3-yl)-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 155523538 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-(2-cyclohexyl-5-methylpyrazol-3-yl)-2-(4-phenylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)Cc2ccc(-c3ccccc3)cc2)n(C2CCCCC2)n1 |
| InChI | InChI=1S/C24H27N3O/c1-18-16-23(27(26-18)22-10-6-3-7-11-22)25-24(28)17-19-12-14-21(15-13-19)20-8-4-2-5-9-20/h2,4-5,8-9,12-16,22H,3,6-7,10-11,17H2,1H3,(H,25,28) |
| InChIKey | BLTLZUGICACQHK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |