C18H22ClN3O — CID 35593226
3-(4-chlorophenyl)-N-(2-cyclopentyl-5-methylpyrazol-3-yl)propanamide (PubChem CID 35593226) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(2-cyclopentyl-5-methylpyrazol-3-yl)propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-(2-cyclopentyl-5-methylpyrazol-3-yl)propanamide |
|---|---|
| PubChem CID | 35593226 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(2-cyclopentyl-5-methylpyrazol-3-yl)propanamide |
| SMILES | Cc1cc(NC(=O)CCc2ccc(Cl)cc2)n(C2CCCC2)n1 |
| InChI | InChI=1S/C18H22ClN3O/c1-13-12-17(22(21-13)16-4-2-3-5-16)20-18(23)11-8-14-6-9-15(19)10-7-14/h6-7,9-10,12,16H,2-5,8,11H2,1H3,(H,20,23) |
| InChIKey | GRLFYTCFBBBJTM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |