C17H19ClN2O — CID 78837758
3-(4-chlorophenyl)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide (PubChem CID 78837758) has the molecular formula C17H19ClN2O and a molecular weight of 302.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 78837758 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(2,4,6-trimethyl-3-pyridinyl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCc2ccc(Cl)cc2)c(C)n1 |
| InChI | InChI=1S/C17H19ClN2O/c1-11-10-12(2)19-13(3)17(11)20-16(21)9-6-14-4-7-15(18)8-5-14/h4-5,7-8,10H,6,9H2,1-3H3,(H,20,21) |
| InChIKey | WLBNKDDLUSYTIW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |