C17H25FN4O3 — CID 72881088
9-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol (PubChem CID 72881088) has the molecular formula C17H25FN4O3 and a molecular weight of 352.41 g/mol. Its IUPAC name is 9-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol.
| Compound Name | 9-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol |
|---|---|
| PubChem CID | 72881088 |
| Molecular Formula | C17H25FN4O3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 9-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1-oxa-9-azaspiro[5.5]undecan-5-ol |
| SMILES | OC1CCCOC12CCN(c1ncc(F)c(N3CCOCC3)n1)CC2 |
| InChI | InChI=1S/C17H25FN4O3/c18-13-12-19-16(20-15(13)21-7-10-24-11-8-21)22-5-3-17(4-6-22)14(23)2-1-9-25-17/h12,14,23H,1-11H2 |
| InChIKey | YRRZLLVTLGQGDI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |