C12H23N3S — CID 728829
(5S,7S)-2-tert-butyl-7-methyl-1,2,4-triazaspiro[4.5]decane-3-thione (PubChem CID 728829) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is (5S,7S)-2-tert-butyl-7-methyl-1,2,4-triazaspiro[4.5]decane-3-thione.
| Compound Name | (5S,7S)-2-tert-butyl-7-methyl-1,2,4-triazaspiro[4.5]decane-3-thione |
|---|---|
| PubChem CID | 728829 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (5S,7S)-2-tert-butyl-7-methyl-1,2,4-triazaspiro[4.5]decane-3-thione |
| SMILES | C[C@H]1CCC[C@]2(C1)NC(=S)N(C(C)(C)C)N2 |
| InChI | InChI=1S/C12H23N3S/c1-9-6-5-7-12(8-9)13-10(16)15(14-12)11(2,3)4/h9,14H,5-8H2,1-4H3,(H,13,16)/t9-,12-/m0/s1 |
| InChIKey | IARFFTLYQWSPOS-CABZTGNLSA-N |
| XLogP | 2.39 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|