C18H23ClN2O5 — CID 72888488
3-(3-chlorophenyl)-3-[[1-(2-methoxyacetyl)piperidine-4-carbonyl]amino]propanoic acid (PubChem CID 72888488) has the molecular formula C18H23ClN2O5 and a molecular weight of 382.84 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-3-[[1-(2-methoxyacetyl)piperidine-4-carbonyl]amino]propanoic acid.
| Compound Name | 3-(3-chlorophenyl)-3-[[1-(2-methoxyacetyl)piperidine-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 72888488 |
| Molecular Formula | C18H23ClN2O5 |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 3-(3-chlorophenyl)-3-[[1-(2-methoxyacetyl)piperidine-4-carbonyl]amino]propanoic acid |
| SMILES | COCC(=O)N1CCC(C(=O)NC(CC(=O)O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H23ClN2O5/c1-26-11-16(22)21-7-5-12(6-8-21)18(25)20-15(10-17(23)24)13-3-2-4-14(19)9-13/h2-4,9,12,15H,5-8,10-11H2,1H3,(H,20,25)(H,23,24) |
| InChIKey | NDFYBGOCJOEODG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |