C21H25F3N3O2+ — CID 7289369
3-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 7289369) has the molecular formula C21H25F3N3O2+ and a molecular weight of 408.44 g/mol. Its IUPAC name is 3-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 3-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 7289369 |
| Molecular Formula | C21H25F3N3O2+ |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 3-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | Cc1ccccc1N1CC[NH+](CCC(=O)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H24F3N3O2/c1-16-4-2-3-5-19(16)27-14-12-26(13-15-27)11-10-20(28)25-17-6-8-18(9-7-17)29-21(22,23)24/h2-9H,10-15H2,1H3,(H,25,28)/p+1 |
| InChIKey | YOIOQJLAVNTXKL-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |