C16H21F3N3O4+ — CID 9020903
2-[4-(2-methoxyacetyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 9020903) has the molecular formula C16H21F3N3O4+ and a molecular weight of 376.36 g/mol. Its IUPAC name is 2-[4-(2-methoxyacetyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4-(2-methoxyacetyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 9020903 |
| Molecular Formula | C16H21F3N3O4+ |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[4-(2-methoxyacetyl)piperazin-1-ium-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | COCC(=O)N1CC[NH+](CC(=O)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H20F3N3O4/c1-25-11-15(24)22-8-6-21(7-9-22)10-14(23)20-12-2-4-13(5-3-12)26-16(17,18)19/h2-5H,6-11H2,1H3,(H,20,23)/p+1 |
| InChIKey | YHRFNRKFYVBQKY-UHFFFAOYSA-O |
| XLogP | -0.10 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |