C16H16N6O3S — CID 72894554
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]methylurea (PubChem CID 72894554) has the molecular formula C16H16N6O3S and a molecular weight of 372.41 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]methylurea.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]methylurea |
|---|---|
| PubChem CID | 72894554 |
| Molecular Formula | C16H16N6O3S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(2-methyl-1,3-thiazol-4-yl)-1,2,4-triazol-3-yl]methylurea |
| SMILES | Cc1nc(-c2nc(CNC(N)=O)n(-c3ccc4c(c3)OCCO4)n2)cs1 |
| InChI | InChI=1S/C16H16N6O3S/c1-9-19-11(8-26-9)15-20-14(7-18-16(17)23)22(21-15)10-2-3-12-13(6-10)25-5-4-24-12/h2-3,6,8H,4-5,7H2,1H3,(H3,17,18,23) |
| InChIKey | YKUZAKCZOTXCGP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |