C19H25N5O3 — CID 72855139
3-[[5-cyclopentyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]methyl]-1,1-dimethylurea (PubChem CID 72855139) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[[5-cyclopentyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[5-cyclopentyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 72855139 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 3-[[5-cyclopentyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]methyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCc1nc(C2CCCC2)nn1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H25N5O3/c1-23(2)19(25)20-12-17-21-18(13-5-3-4-6-13)22-24(17)14-7-8-15-16(11-14)27-10-9-26-15/h7-8,11,13H,3-6,9-10,12H2,1-2H3,(H,20,25) |
| InChIKey | DXHWNNVMOWIUIR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |