C18H15N7O2 — CID 50980083
2-[5-cyclopropyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 50980083) has the molecular formula C18H15N7O2 and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-[5-cyclopropyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-[5-cyclopropyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 50980083 |
| Molecular Formula | C18H15N7O2 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-[5-cyclopropyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | c1cnc2nc(-c3nc(C4CC4)nn3-c3ccc4c(c3)OCCO4)nn2c1 |
| InChI | InChI=1S/C18H15N7O2/c1-6-19-18-21-16(22-24(18)7-1)17-20-15(11-2-3-11)23-25(17)12-4-5-13-14(10-12)27-9-8-26-13/h1,4-7,10-11H,2-3,8-9H2 |
| InChIKey | ZRVQRQWTAQENLV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |